C21H28IN3O3S — CID 111140488
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[4-(phenoxymethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111140488) has the molecular formula C21H28IN3O3S and a molecular weight of 529.44 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[4-(phenoxymethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[4-(phenoxymethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111140488 |
| Molecular Formula | C21H28IN3O3S |
| Molecular Weight | 529.44 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[4-(phenoxymethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(COc2ccccc2)cc1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C21H27N3O3S.HI/c1-2-22-21(24-19-12-13-28(25,26)16-19)23-14-17-8-10-18(11-9-17)15-27-20-6-4-3-5-7-20;/h3-11,19H,2,12-16H2,1H3,(H2,22,23,24);1H |
| InChIKey | CUOOZDYQNLUZMJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|