C22H27N3O4S — CID 111141103
benzyl 3-[[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]methyl]benzoate (PubChem CID 111141103) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is benzyl 3-[[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]methyl]benzoate.
| Compound Name | benzyl 3-[[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]methyl]benzoate |
|---|---|
| PubChem CID | 111141103 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | benzyl 3-[[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]methyl]benzoate |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)OCc2ccccc2)c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H27N3O4S/c1-2-23-22(25-20-11-12-30(27,28)16-20)24-14-18-9-6-10-19(13-18)21(26)29-15-17-7-4-3-5-8-17/h3-10,13,20H,2,11-12,14-16H2,1H3,(H2,23,24,25) |
| InChIKey | RPOXTDKODSHGAC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|