C20H31IN4O3S — CID 111142566
N-[3-[[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide (PubChem CID 111142566) has the molecular formula C20H31IN4O3S and a molecular weight of 534.46 g/mol. Its IUPAC name is N-[3-[[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide.
| Compound Name | N-[3-[[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111142566 |
| Molecular Formula | C20H31IN4O3S |
| Molecular Weight | 534.46 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | N-[3-[[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C2CCCC2)c1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C20H30N4O3S.HI/c1-2-21-20(24-18-10-11-28(26,27)14-18)22-13-15-6-5-9-17(12-15)23-19(25)16-7-3-4-8-16;/h5-6,9,12,16,18H,2-4,7-8,10-11,13-14H2,1H3,(H,23,25)(H2,21,22,24);1H |
| InChIKey | DKRMXFXDHCDFMA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|