C18H27IN4O3S — CID 111142616
N-[3-[[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide;hydroiodide (PubChem CID 111142616) has the molecular formula C18H27IN4O3S and a molecular weight of 506.41 g/mol. Its IUPAC name is N-[3-[[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide;hydroiodide.
| Compound Name | N-[3-[[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111142616 |
| Molecular Formula | C18H27IN4O3S |
| Molecular Weight | 506.41 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | N-[3-[[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(NC(=O)C2CCC2)c1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C18H26N4O3S.HI/c1-19-18(22-16-8-9-26(24,25)12-16)20-11-13-4-2-7-15(10-13)21-17(23)14-5-3-6-14;/h2,4,7,10,14,16H,3,5-6,8-9,11-12H2,1H3,(H,21,23)(H2,19,20,22);1H |
| InChIKey | SHSCVVPPUSQZJP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|