C22H34N4O2S — CID 109436847
N-[3-[[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide (PubChem CID 109436847) has the molecular formula C22H34N4O2S and a molecular weight of 418.61 g/mol. Its IUPAC name is N-[3-[[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 109436847 |
| Molecular Formula | C22H34N4O2S |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | N-[3-[[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclobutanecarboxamide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCc2cccc(NC(=O)C3CCC3)c2)C1 |
| InChI | InChI=1S/C22H34N4O2S/c1-3-29(28)20-12-6-11-19(14-20)26-22(23-2)24-15-16-7-4-10-18(13-16)25-21(27)17-8-5-9-17/h4,7,10,13,17,19-20H,3,5-6,8-9,11-12,14-15H2,1-2H3,(H,25,27)(H2,23,24,26) |
| InChIKey | AHXDPGASHLTYHX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|