C22H34N4O3S — CID 109438365
N-cyclopropyl-2-[3-[[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide (PubChem CID 109438365) has the molecular formula C22H34N4O3S and a molecular weight of 434.61 g/mol. Its IUPAC name is N-cyclopropyl-2-[3-[[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide.
| Compound Name | N-cyclopropyl-2-[3-[[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 109438365 |
| Molecular Formula | C22H34N4O3S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | N-cyclopropyl-2-[3-[[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCc2cccc(OCC(=O)NC3CC3)c2)C1 |
| InChI | InChI=1S/C22H34N4O3S/c1-3-30(28)20-9-5-7-18(13-20)26-22(23-2)24-14-16-6-4-8-19(12-16)29-15-21(27)25-17-10-11-17/h4,6,8,12,17-18,20H,3,5,7,9-11,13-15H2,1-2H3,(H,25,27)(H2,23,24,26) |
| InChIKey | JLJYEUZXEDGLHA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|