C20H31N3O4S — CID 109441051
methyl 4-[[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]methyl]-2-methoxybenzoate (PubChem CID 109441051) has the molecular formula C20H31N3O4S and a molecular weight of 409.55 g/mol. Its IUPAC name is methyl 4-[[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]methyl]-2-methoxybenzoate.
| Compound Name | methyl 4-[[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 109441051 |
| Molecular Formula | C20H31N3O4S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | methyl 4-[[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]methyl]-2-methoxybenzoate |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCc2ccc(C(=O)OC)c(OC)c2)C1 |
| InChI | InChI=1S/C20H31N3O4S/c1-5-28(25)16-8-6-7-15(12-16)23-20(21-2)22-13-14-9-10-17(19(24)27-4)18(11-14)26-3/h9-11,15-16H,5-8,12-13H2,1-4H3,(H2,21,22,23) |
| InChIKey | ZEDDHXOWUSGBEI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|