C20H34IN3O4S — CID 109439072
1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 109439072) has the molecular formula C20H34IN3O4S and a molecular weight of 539.48 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109439072 |
| Molecular Formula | C20H34IN3O4S |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCc2ccc(OC)c(OC)c2OC)C1.I |
| InChI | InChI=1S/C20H33N3O4S.HI/c1-6-28(24)16-9-7-8-15(12-16)23-20(21-2)22-13-14-10-11-17(25-3)19(27-5)18(14)26-4;/h10-11,15-16H,6-9,12-13H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | AZZXCNSXLCJBHZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|