C21H36IN3O2S2 — CID 109438280
1-(3-ethylsulfinylcyclohexyl)-3-[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]-2-methylguanidine;hydroiodide (PubChem CID 109438280) has the molecular formula C21H36IN3O2S2 and a molecular weight of 553.58 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-3-[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-3-[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109438280 |
| Molecular Formula | C21H36IN3O2S2 |
| Molecular Weight | 553.58 g/mol |
| Exact Mass | 553.13 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-3-[3-(2-methoxyphenyl)sulfanyl-2-methylpropyl]-2-methylguanidine;hydroiodide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCC(C)CSc2ccccc2OC)C1.I |
| InChI | InChI=1S/C21H35N3O2S2.HI/c1-5-28(25)18-10-8-9-17(13-18)24-21(22-3)23-14-16(2)15-27-20-12-7-6-11-19(20)26-4;/h6-7,11-12,16-18H,5,8-10,13-15H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | HHWYMZWINXQCGJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|