C12H23F2N3OS — CID 109438875
1-(2,2-difluoroethyl)-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine (PubChem CID 109438875) has the molecular formula C12H23F2N3OS and a molecular weight of 295.40 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine.
| Compound Name | 1-(2,2-difluoroethyl)-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine |
|---|---|
| PubChem CID | 109438875 |
| Molecular Formula | C12H23F2N3OS |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCC(F)F)C1 |
| InChI | InChI=1S/C12H23F2N3OS/c1-3-19(18)10-6-4-5-9(7-10)17-12(15-2)16-8-11(13)14/h9-11H,3-8H2,1-2H3,(H2,15,16,17) |
| InChIKey | FUOFRLPTVCKBOS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|