C18H36N4OS — CID 109441169
1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-(2-methyl-3-pyrrolidin-1-ylpropyl)guanidine (PubChem CID 109441169) has the molecular formula C18H36N4OS and a molecular weight of 356.58 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-(2-methyl-3-pyrrolidin-1-ylpropyl)guanidine.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-(2-methyl-3-pyrrolidin-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 109441169 |
| Molecular Formula | C18H36N4OS |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-(2-methyl-3-pyrrolidin-1-ylpropyl)guanidine |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCC(C)CN2CCCC2)C1 |
| InChI | InChI=1S/C18H36N4OS/c1-4-24(23)17-9-7-8-16(12-17)21-18(19-3)20-13-15(2)14-22-10-5-6-11-22/h15-17H,4-14H2,1-3H3,(H2,19,20,21) |
| InChIKey | JLVLCYCSFBCQMJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|