C20H41IN4OS — CID 109439416
1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[[1-(2-methylpropyl)piperidin-2-yl]methyl]guanidine;hydroiodide (PubChem CID 109439416) has the molecular formula C20H41IN4OS and a molecular weight of 512.55 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[[1-(2-methylpropyl)piperidin-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[[1-(2-methylpropyl)piperidin-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109439416 |
| Molecular Formula | C20H41IN4OS |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[[1-(2-methylpropyl)piperidin-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCC2CCCCN2CC(C)C)C1.I |
| InChI | InChI=1S/C20H40N4OS.HI/c1-5-26(25)19-11-8-9-17(13-19)23-20(21-4)22-14-18-10-6-7-12-24(18)15-16(2)3;/h16-19H,5-15H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | SHLYHVBSCXQJPU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|