C17H33N3O2S — CID 71976524
1-[(1-ethylpiperidin-2-yl)methyl]-3-(3-ethylsulfinylcyclohexyl)urea (PubChem CID 71976524) has the molecular formula C17H33N3O2S and a molecular weight of 343.54 g/mol. Its IUPAC name is 1-[(1-ethylpiperidin-2-yl)methyl]-3-(3-ethylsulfinylcyclohexyl)urea.
| Compound Name | 1-[(1-ethylpiperidin-2-yl)methyl]-3-(3-ethylsulfinylcyclohexyl)urea |
|---|---|
| PubChem CID | 71976524 |
| Molecular Formula | C17H33N3O2S |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 1-[(1-ethylpiperidin-2-yl)methyl]-3-(3-ethylsulfinylcyclohexyl)urea |
| SMILES | CCN1CCCCC1CNC(=O)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C17H33N3O2S/c1-3-20-11-6-5-9-15(20)13-18-17(21)19-14-8-7-10-16(12-14)23(22)4-2/h14-16H,3-13H2,1-2H3,(H2,18,19,21) |
| InChIKey | SHVABOGRMBHZLE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |