C21H43IN4OS — CID 109437800
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[[1-(2-methylpropyl)piperidin-2-yl]methyl]guanidine;hydroiodide (PubChem CID 109437800) has the molecular formula C21H43IN4OS and a molecular weight of 526.57 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[[1-(2-methylpropyl)piperidin-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[[1-(2-methylpropyl)piperidin-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109437800 |
| Molecular Formula | C21H43IN4OS |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[[1-(2-methylpropyl)piperidin-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCCCN1CC(C)C)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C21H42N4OS.HI/c1-5-22-21(24-18-10-9-12-20(14-18)27(26)6-2)23-15-19-11-7-8-13-25(19)16-17(3)4;/h17-20H,5-16H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | ZVKYCDUFLWEBPA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|