C19H38IN3OS — CID 109439382
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[(4-methylcyclohexyl)methyl]guanidine;hydroiodide (PubChem CID 109439382) has the molecular formula C19H38IN3OS and a molecular weight of 483.50 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[(4-methylcyclohexyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[(4-methylcyclohexyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109439382 |
| Molecular Formula | C19H38IN3OS |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[(4-methylcyclohexyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCC(C)CC1)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C19H37N3OS.HI/c1-4-20-19(21-14-16-11-9-15(3)10-12-16)22-17-7-6-8-18(13-17)24(23)5-2;/h15-18H,4-14H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | GHEMLBYHOWJTGL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|