C17H35N3OS — CID 109438567
1-ethyl-2-(2-ethylbutyl)-3-(3-ethylsulfinylcyclohexyl)guanidine (PubChem CID 109438567) has the molecular formula C17H35N3OS and a molecular weight of 329.55 g/mol. Its IUPAC name is 1-ethyl-2-(2-ethylbutyl)-3-(3-ethylsulfinylcyclohexyl)guanidine.
| Compound Name | 1-ethyl-2-(2-ethylbutyl)-3-(3-ethylsulfinylcyclohexyl)guanidine |
|---|---|
| PubChem CID | 109438567 |
| Molecular Formula | C17H35N3OS |
| Molecular Weight | 329.55 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | 1-ethyl-2-(2-ethylbutyl)-3-(3-ethylsulfinylcyclohexyl)guanidine |
| SMILES | CCN/C(=N\CC(CC)CC)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C17H35N3OS/c1-5-14(6-2)13-19-17(18-7-3)20-15-10-9-11-16(12-15)22(21)8-4/h14-16H,5-13H2,1-4H3,(H2,18,19,20) |
| InChIKey | OCFLATVFKCEBGT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|