C21H35N3O2S — CID 109439737
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(4-methylphenoxy)propyl]guanidine (PubChem CID 109439737) has the molecular formula C21H35N3O2S and a molecular weight of 393.60 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(4-methylphenoxy)propyl]guanidine.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(4-methylphenoxy)propyl]guanidine |
|---|---|
| PubChem CID | 109439737 |
| Molecular Formula | C21H35N3O2S |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(4-methylphenoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)Oc1ccc(C)cc1)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C21H35N3O2S/c1-5-22-21(24-18-8-7-9-20(14-18)27(25)6-2)23-15-17(4)26-19-12-10-16(3)11-13-19/h10-13,17-18,20H,5-9,14-15H2,1-4H3,(H2,22,23,24) |
| InChIKey | HTZGVSHODIOWLB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|