C20H34IN3O2S — CID 109437396
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-(2-methoxy-2-phenylethyl)guanidine;hydroiodide (PubChem CID 109437396) has the molecular formula C20H34IN3O2S and a molecular weight of 507.48 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-(2-methoxy-2-phenylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-(2-methoxy-2-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109437396 |
| Molecular Formula | C20H34IN3O2S |
| Molecular Weight | 507.48 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-(2-methoxy-2-phenylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(OC)c1ccccc1)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C20H33N3O2S.HI/c1-4-21-20(22-15-19(25-3)16-10-7-6-8-11-16)23-17-12-9-13-18(14-17)26(24)5-2;/h6-8,10-11,17-19H,4-5,9,12-15H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | MWEUTKBSAAYKTN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|