C17H29N3O3S — CID 109438733
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(furan-2-yl)-2-hydroxyethyl]guanidine (PubChem CID 109438733) has the molecular formula C17H29N3O3S and a molecular weight of 355.50 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(furan-2-yl)-2-hydroxyethyl]guanidine.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(furan-2-yl)-2-hydroxyethyl]guanidine |
|---|---|
| PubChem CID | 109438733 |
| Molecular Formula | C17H29N3O3S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[2-(furan-2-yl)-2-hydroxyethyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccco1)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C17H29N3O3S/c1-3-18-17(19-12-15(21)16-9-6-10-23-16)20-13-7-5-8-14(11-13)24(22)4-2/h6,9-10,13-15,21H,3-5,7-8,11-12H2,1-2H3,(H2,18,19,20) |
| InChIKey | ZCLOIBKNVPMTAC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|