C18H32IN3O4S3 — CID 109437094
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-(2-hydroxy-3-thiophen-2-ylsulfonylpropyl)guanidine;hydroiodide (PubChem CID 109437094) has the molecular formula C18H32IN3O4S3 and a molecular weight of 577.58 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-(2-hydroxy-3-thiophen-2-ylsulfonylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-(2-hydroxy-3-thiophen-2-ylsulfonylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109437094 |
| Molecular Formula | C18H32IN3O4S3 |
| Molecular Weight | 577.58 g/mol |
| Exact Mass | 577.06 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-(2-hydroxy-3-thiophen-2-ylsulfonylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)CS(=O)(=O)c1cccs1)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C18H31N3O4S3.HI/c1-3-19-18(21-14-7-5-8-16(11-14)27(23)4-2)20-12-15(22)13-28(24,25)17-9-6-10-26-17;/h6,9-10,14-16,22H,3-5,7-8,11-13H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | VXHBUCCGRPYZEO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.58 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|