C19H32N4O2S2 — CID 109438019
N-[3-[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]propyl]thiophene-2-carboxamide (PubChem CID 109438019) has the molecular formula C19H32N4O2S2 and a molecular weight of 412.63 g/mol. Its IUPAC name is N-[3-[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 109438019 |
| Molecular Formula | C19H32N4O2S2 |
| Molecular Weight | 412.63 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | N-[3-[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]propyl]thiophene-2-carboxamide |
| SMILES | CCN/C(=N\CCCNC(=O)c1cccs1)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C19H32N4O2S2/c1-3-20-19(23-15-8-5-9-16(14-15)27(25)4-2)22-12-7-11-21-18(24)17-10-6-13-26-17/h6,10,13,15-16H,3-5,7-9,11-12,14H2,1-2H3,(H,21,24)(H2,20,22,23) |
| InChIKey | KYSPSZQYWDPMPP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.63 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|