C20H32FN3O3S — CID 109437385
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]guanidine (PubChem CID 109437385) has the molecular formula C20H32FN3O3S and a molecular weight of 413.56 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]guanidine.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]guanidine |
|---|---|
| PubChem CID | 109437385 |
| Molecular Formula | C20H32FN3O3S |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]guanidine |
| SMILES | CCN/C(=N\CC(O)COc1ccc(F)cc1)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C20H32FN3O3S/c1-3-22-20(24-16-6-5-7-19(12-16)28(26)4-2)23-13-17(25)14-27-18-10-8-15(21)9-11-18/h8-11,16-17,19,25H,3-7,12-14H2,1-2H3,(H2,22,23,24) |
| InChIKey | FOJXBPCSGAAFIO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|