C19H28F4IN3O2 — CID 111992358
1-ethyl-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]-3-[4-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide (PubChem CID 111992358) has the molecular formula C19H28F4IN3O2 and a molecular weight of 533.35 g/mol. Its IUPAC name is 1-ethyl-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]-3-[4-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]-3-[4-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111992358 |
| Molecular Formula | C19H28F4IN3O2 |
| Molecular Weight | 533.35 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 1-ethyl-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]-3-[4-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)COc1ccc(F)cc1)NC1CCC(C(F)(F)F)CC1.I |
| InChI | InChI=1S/C19H27F4N3O2.HI/c1-2-24-18(26-15-7-3-13(4-8-15)19(21,22)23)25-11-16(27)12-28-17-9-5-14(20)6-10-17;/h5-6,9-10,13,15-16,27H,2-4,7-8,11-12H2,1H3,(H2,24,25,26);1H |
| InChIKey | GGWRDHDWDRIMRU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|