C22H35FN4O3 — CID 111995063
3-[[N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]carbamimidoyl]amino]-N-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 111995063) has the molecular formula C22H35FN4O3 and a molecular weight of 422.55 g/mol. Its IUPAC name is 3-[[N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]carbamimidoyl]amino]-N-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | 3-[[N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]carbamimidoyl]amino]-N-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 111995063 |
| Molecular Formula | C22H35FN4O3 |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 3-[[N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]carbamimidoyl]amino]-N-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | CCN/C(=N\CC(O)COc1ccc(F)cc1)NC1CCCC(C(=O)NC(C)C)C1 |
| InChI | InChI=1S/C22H35FN4O3/c1-4-24-22(25-13-19(28)14-30-20-10-8-17(23)9-11-20)27-18-7-5-6-16(12-18)21(29)26-15(2)3/h8-11,15-16,18-19,28H,4-7,12-14H2,1-3H3,(H,26,29)(H2,24,25,27) |
| InChIKey | ANQJFQGFNPFYCF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|