C20H31FN4O4 — CID 111329966
ethyl 4-[[N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111329966) has the molecular formula C20H31FN4O4 and a molecular weight of 410.49 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111329966 |
| Molecular Formula | C20H31FN4O4 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\CC(O)COc1ccc(F)cc1)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C20H31FN4O4/c1-3-22-19(24-16-9-11-25(12-10-16)20(27)28-4-2)23-13-17(26)14-29-18-7-5-15(21)6-8-18/h5-8,16-17,26H,3-4,9-14H2,1-2H3,(H2,22,23,24) |
| InChIKey | YSQINLGBWDJUAB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|