C23H31FIN5O3 — CID 111328953
ethyl 4-[[N-ethyl-N'-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111328953) has the molecular formula C23H31FIN5O3 and a molecular weight of 571.44 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-ethyl-N'-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111328953 |
| Molecular Formula | C23H31FIN5O3 |
| Molecular Weight | 571.44 g/mol |
| Exact Mass | 571.15 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Oc2ccc(F)cc2)nc1)NC1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C23H30FN5O3.HI/c1-3-25-22(28-19-11-13-29(14-12-19)23(30)31-4-2)27-16-17-5-10-21(26-15-17)32-20-8-6-18(24)7-9-20;/h5-10,15,19H,3-4,11-14,16H2,1-2H3,(H2,25,27,28);1H |
| InChIKey | MSBHJSPKPLQAQD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|