C19H28F3N5O3 — CID 111328080
ethyl 4-[[N-ethyl-N'-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111328080) has the molecular formula C19H28F3N5O3 and a molecular weight of 431.46 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-ethyl-N'-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111328080 |
| Molecular Formula | C19H28F3N5O3 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)nc1)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C19H28F3N5O3/c1-3-23-17(26-15-7-9-27(10-8-15)18(28)29-4-2)25-12-14-5-6-16(24-11-14)30-13-19(20,21)22/h5-6,11,15H,3-4,7-10,12-13H2,1-2H3,(H2,23,25,26) |
| InChIKey | ZSIDAHWOVKCYNW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|