C22H36N6O3 — CID 111327118
ethyl 4-[[N-ethyl-N'-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111327118) has the molecular formula C22H36N6O3 and a molecular weight of 432.57 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-ethyl-N'-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111327118 |
| Molecular Formula | C22H36N6O3 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1ccc(N2CCOC(C)C2)nc1)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C22H36N6O3/c1-4-23-21(26-19-8-10-27(11-9-19)22(29)30-5-2)25-15-18-6-7-20(24-14-18)28-12-13-31-17(3)16-28/h6-7,14,17,19H,4-5,8-13,15-16H2,1-3H3,(H2,23,25,26) |
| InChIKey | SWWCIFDLZLPFDM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|