C19H30N4O2 — CID 111328040
ethyl 4-[[N-ethyl-N'-[(3-methylphenyl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111328040) has the molecular formula C19H30N4O2 and a molecular weight of 346.47 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[(3-methylphenyl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-ethyl-N'-[(3-methylphenyl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111328040 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[(3-methylphenyl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1cccc(C)c1)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C19H30N4O2/c1-4-20-18(21-14-16-8-6-7-15(3)13-16)22-17-9-11-23(12-10-17)19(24)25-5-2/h6-8,13,17H,4-5,9-12,14H2,1-3H3,(H2,20,21,22) |
| InChIKey | IYKSXGDGRRHMKI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|