C19H27F3N4O2 — CID 111329426
ethyl 4-[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111329426) has the molecular formula C19H27F3N4O2 and a molecular weight of 400.45 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111329426 |
| Molecular Formula | C19H27F3N4O2 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C19H27F3N4O2/c1-3-23-17(24-13-14-6-5-7-15(12-14)19(20,21)22)25-16-8-10-26(11-9-16)18(27)28-4-2/h5-7,12,16H,3-4,8-11,13H2,1-2H3,(H2,23,24,25) |
| InChIKey | NHGAUFGVSJBAEA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|