C22H28FIN4O3 — CID 111253880
methyl 1-[N-ethyl-N'-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111253880) has the molecular formula C22H28FIN4O3 and a molecular weight of 542.39 g/mol. Its IUPAC name is methyl 1-[N-ethyl-N'-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N-ethyl-N'-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111253880 |
| Molecular Formula | C22H28FIN4O3 |
| Molecular Weight | 542.39 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | methyl 1-[N-ethyl-N'-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Oc2ccc(F)cc2)nc1)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C22H27FN4O3.HI/c1-3-24-22(27-12-10-17(11-13-27)21(28)29-2)26-15-16-4-9-20(25-14-16)30-19-7-5-18(23)6-8-19;/h4-9,14,17H,3,10-13,15H2,1-2H3,(H,24,26);1H |
| InChIKey | XRPASTOJPABELU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|