C24H33IN4O3 — CID 111252232
methyl 1-[N'-[[2-(3,4-dimethylphenoxy)-4-pyridinyl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111252232) has the molecular formula C24H33IN4O3 and a molecular weight of 552.46 g/mol. Its IUPAC name is methyl 1-[N'-[[2-(3,4-dimethylphenoxy)-4-pyridinyl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N'-[[2-(3,4-dimethylphenoxy)-4-pyridinyl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111252232 |
| Molecular Formula | C24H33IN4O3 |
| Molecular Weight | 552.46 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | methyl 1-[N'-[[2-(3,4-dimethylphenoxy)-4-pyridinyl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnc(Oc2ccc(C)c(C)c2)c1)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C24H32N4O3.HI/c1-5-25-24(28-12-9-20(10-13-28)23(29)30-4)27-16-19-8-11-26-22(15-19)31-21-7-6-17(2)18(3)14-21;/h6-8,11,14-15,20H,5,9-10,12-13,16H2,1-4H3,(H,25,27);1H |
| InChIKey | RLHVONAYAGUOBA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|