C19H23FN4O — CID 110955872
N-ethyl-N'-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]pyrrolidine-1-carboximidamide (PubChem CID 110955872) has the molecular formula C19H23FN4O and a molecular weight of 342.42 g/mol. Its IUPAC name is N-ethyl-N'-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 110955872 |
| Molecular Formula | C19H23FN4O |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-ethyl-N'-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccnc(Oc2ccc(F)cc2)c1)N1CCCC1 |
| InChI | InChI=1S/C19H23FN4O/c1-2-21-19(24-11-3-4-12-24)23-14-15-9-10-22-18(13-15)25-17-7-5-16(20)6-8-17/h5-10,13H,2-4,11-12,14H2,1H3,(H,21,23) |
| InChIKey | IHGDEXDXSRGQFQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|