C20H26FN5O — CID 111165778
N-ethyl-4-(4-fluorophenyl)-N'-[(2-methoxy-4-pyridinyl)methyl]piperazine-1-carboximidamide (PubChem CID 111165778) has the molecular formula C20H26FN5O and a molecular weight of 371.46 g/mol. Its IUPAC name is N-ethyl-4-(4-fluorophenyl)-N'-[(2-methoxy-4-pyridinyl)methyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(4-fluorophenyl)-N'-[(2-methoxy-4-pyridinyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111165778 |
| Molecular Formula | C20H26FN5O |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | N-ethyl-4-(4-fluorophenyl)-N'-[(2-methoxy-4-pyridinyl)methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccnc(OC)c1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H26FN5O/c1-3-22-20(24-15-16-8-9-23-19(14-16)27-2)26-12-10-25(11-13-26)18-6-4-17(21)5-7-18/h4-9,14H,3,10-13,15H2,1-2H3,(H,22,24) |
| InChIKey | FHPWAQIYPBJBLK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|