C23H26FN7O — CID 111207608
N-ethyl-N'-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111207608) has the molecular formula C23H26FN7O and a molecular weight of 435.51 g/mol. Its IUPAC name is N-ethyl-N'-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111207608 |
| Molecular Formula | C23H26FN7O |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | N-ethyl-N'-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccnc(Oc2ccc(F)cc2)c1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C23H26FN7O/c1-2-25-22(30-12-14-31(15-13-30)23-27-9-3-10-28-23)29-17-18-8-11-26-21(16-18)32-20-6-4-19(24)5-7-20/h3-11,16H,2,12-15,17H2,1H3,(H,25,29) |
| InChIKey | UBKGFMHTAISXLL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|