C23H29N7O — CID 111242647
N-ethyl-4-(4-methoxyphenyl)-N'-[(2-pyrazol-1-yl-4-pyridinyl)methyl]piperazine-1-carboximidamide (PubChem CID 111242647) has the molecular formula C23H29N7O and a molecular weight of 419.53 g/mol. Its IUPAC name is N-ethyl-4-(4-methoxyphenyl)-N'-[(2-pyrazol-1-yl-4-pyridinyl)methyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(4-methoxyphenyl)-N'-[(2-pyrazol-1-yl-4-pyridinyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111242647 |
| Molecular Formula | C23H29N7O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | N-ethyl-4-(4-methoxyphenyl)-N'-[(2-pyrazol-1-yl-4-pyridinyl)methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccnc(-n2cccn2)c1)N1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C23H29N7O/c1-3-24-23(26-18-19-9-11-25-22(17-19)30-12-4-10-27-30)29-15-13-28(14-16-29)20-5-7-21(31-2)8-6-20/h4-12,17H,3,13-16,18H2,1-2H3,(H,24,26) |
| InChIKey | ONPXGJBRQMGUOT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|