C19H32IN5O2 — CID 111156176
ethyl 1-[N'-[[2-(dimethylamino)-4-pyridinyl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111156176) has the molecular formula C19H32IN5O2 and a molecular weight of 489.40 g/mol. Its IUPAC name is ethyl 1-[N'-[[2-(dimethylamino)-4-pyridinyl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-[[2-(dimethylamino)-4-pyridinyl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111156176 |
| Molecular Formula | C19H32IN5O2 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | ethyl 1-[N'-[[2-(dimethylamino)-4-pyridinyl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnc(N(C)C)c1)N1CCC(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C19H31N5O2.HI/c1-5-20-19(22-14-15-7-10-21-17(13-15)23(3)4)24-11-8-16(9-12-24)18(25)26-6-2;/h7,10,13,16H,5-6,8-9,11-12,14H2,1-4H3,(H,20,22);1H |
| InChIKey | VDIYHOUYMUXLGT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|