C17H30IN5 — CID 111739593
N'-[[2-(dimethylamino)-4-pyridinyl]methyl]-N-ethyl-3,3-dimethylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111739593) has the molecular formula C17H30IN5 and a molecular weight of 431.37 g/mol. Its IUPAC name is N'-[[2-(dimethylamino)-4-pyridinyl]methyl]-N-ethyl-3,3-dimethylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[2-(dimethylamino)-4-pyridinyl]methyl]-N-ethyl-3,3-dimethylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111739593 |
| Molecular Formula | C17H30IN5 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | N'-[[2-(dimethylamino)-4-pyridinyl]methyl]-N-ethyl-3,3-dimethylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnc(N(C)C)c1)N1CCC(C)(C)C1.I |
| InChI | InChI=1S/C17H29N5.HI/c1-6-18-16(22-10-8-17(2,3)13-22)20-12-14-7-9-19-15(11-14)21(4)5;/h7,9,11H,6,8,10,12-13H2,1-5H3,(H,18,20);1H |
| InChIKey | QBPFZDCVPYAGNI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|