C15H25N5O — CID 111549862
(3R)-N'-[[2-(dimethylamino)-4-pyridinyl]methyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide (PubChem CID 111549862) has the molecular formula C15H25N5O and a molecular weight of 291.40 g/mol. Its IUPAC name is (3R)-N'-[[2-(dimethylamino)-4-pyridinyl]methyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide.
| Compound Name | (3R)-N'-[[2-(dimethylamino)-4-pyridinyl]methyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111549862 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | (3R)-N'-[[2-(dimethylamino)-4-pyridinyl]methyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccnc(N(C)C)c1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C15H25N5O/c1-4-16-15(20-8-6-13(21)11-20)18-10-12-5-7-17-14(9-12)19(2)3/h5,7,9,13,21H,4,6,8,10-11H2,1-3H3,(H,16,18)/t13-/m1/s1 |
| InChIKey | RGWWMBZHHNGSJH-CYBMUJFWSA-N |
| XLogP | 0.68 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|