C18H27BrIN3O2 — CID 111155279
ethyl 1-[N'-[(3-bromophenyl)methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111155279) has the molecular formula C18H27BrIN3O2 and a molecular weight of 524.24 g/mol. Its IUPAC name is ethyl 1-[N'-[(3-bromophenyl)methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-[(3-bromophenyl)methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111155279 |
| Molecular Formula | C18H27BrIN3O2 |
| Molecular Weight | 524.24 g/mol |
| Exact Mass | 523.03 |
| IUPAC Name | ethyl 1-[N'-[(3-bromophenyl)methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(Br)c1)N1CCC(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C18H26BrN3O2.HI/c1-3-20-18(21-13-14-6-5-7-16(19)12-14)22-10-8-15(9-11-22)17(23)24-4-2;/h5-7,12,15H,3-4,8-11,13H2,1-2H3,(H,20,21);1H |
| InChIKey | IQWMRBGNHYCKET-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|