C21H36FIN4O2 — CID 111992314
1-ethyl-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]-3-[1-(2-methylpropyl)piperidin-4-yl]guanidine;hydroiodide (PubChem CID 111992314) has the molecular formula C21H36FIN4O2 and a molecular weight of 522.45 g/mol. Its IUPAC name is 1-ethyl-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]-3-[1-(2-methylpropyl)piperidin-4-yl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]-3-[1-(2-methylpropyl)piperidin-4-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111992314 |
| Molecular Formula | C21H36FIN4O2 |
| Molecular Weight | 522.45 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 1-ethyl-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]-3-[1-(2-methylpropyl)piperidin-4-yl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)COc1ccc(F)cc1)NC1CCN(CC(C)C)CC1.I |
| InChI | InChI=1S/C21H35FN4O2.HI/c1-4-23-21(25-18-9-11-26(12-10-18)14-16(2)3)24-13-19(27)15-28-20-7-5-17(22)6-8-20;/h5-8,16,18-19,27H,4,9-15H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | VFJLTBPEJVJULB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|