C23H33FIN5O2 — CID 111994686
1-ethyl-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]-3-[1-(5-methyl-2-pyridinyl)piperidin-4-yl]guanidine;hydroiodide (PubChem CID 111994686) has the molecular formula C23H33FIN5O2 and a molecular weight of 557.45 g/mol. Its IUPAC name is 1-ethyl-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]-3-[1-(5-methyl-2-pyridinyl)piperidin-4-yl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]-3-[1-(5-methyl-2-pyridinyl)piperidin-4-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111994686 |
| Molecular Formula | C23H33FIN5O2 |
| Molecular Weight | 557.45 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 1-ethyl-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]-3-[1-(5-methyl-2-pyridinyl)piperidin-4-yl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)COc1ccc(F)cc1)NC1CCN(c2ccc(C)cn2)CC1.I |
| InChI | InChI=1S/C23H32FN5O2.HI/c1-3-25-23(27-15-20(30)16-31-21-7-5-18(24)6-8-21)28-19-10-12-29(13-11-19)22-9-4-17(2)14-26-22;/h4-9,14,19-20,30H,3,10-13,15-16H2,1-2H3,(H2,25,27,28);1H |
| InChIKey | QQRRPVPYGXNIFT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|