C20H35IN6O — CID 111993158
N-[2-[[ethylamino-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]amino]methylidene]amino]ethyl]-2-methylpropanamide;hydroiodide (PubChem CID 111993158) has the molecular formula C20H35IN6O and a molecular weight of 502.45 g/mol. Its IUPAC name is N-[2-[[ethylamino-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]amino]methylidene]amino]ethyl]-2-methylpropanamide;hydroiodide.
| Compound Name | N-[2-[[ethylamino-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]amino]methylidene]amino]ethyl]-2-methylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111993158 |
| Molecular Formula | C20H35IN6O |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | N-[2-[[ethylamino-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]amino]methylidene]amino]ethyl]-2-methylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)C(C)C)NC1CCN(c2ccc(C)cn2)CC1.I |
| InChI | InChI=1S/C20H34N6O.HI/c1-5-21-20(23-11-10-22-19(27)15(2)3)25-17-8-12-26(13-9-17)18-7-6-16(4)14-24-18;/h6-7,14-15,17H,5,8-13H2,1-4H3,(H,22,27)(H2,21,23,25);1H |
| InChIKey | IYYSELOCWSYSTF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|