C16H32F2IN5O — CID 111992910
N-[2-[[[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-(ethylamino)methylidene]amino]ethyl]-2-methylpropanamide;hydroiodide (PubChem CID 111992910) has the molecular formula C16H32F2IN5O and a molecular weight of 475.37 g/mol. Its IUPAC name is N-[2-[[[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-(ethylamino)methylidene]amino]ethyl]-2-methylpropanamide;hydroiodide.
| Compound Name | N-[2-[[[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-(ethylamino)methylidene]amino]ethyl]-2-methylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111992910 |
| Molecular Formula | C16H32F2IN5O |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | N-[2-[[[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-(ethylamino)methylidene]amino]ethyl]-2-methylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)C(C)C)NC1CCN(CC(F)F)CC1.I |
| InChI | InChI=1S/C16H31F2N5O.HI/c1-4-19-16(21-8-7-20-15(24)12(2)3)22-13-5-9-23(10-6-13)11-14(17)18;/h12-14H,4-11H2,1-3H3,(H,20,24)(H2,19,21,22);1H |
| InChIKey | WRUTXULEAPVEAZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|