C21H33Cl2N5O — CID 111994673
N-[2-[[[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]amino]-(ethylamino)methylidene]amino]ethyl]-2-methylpropanamide (PubChem CID 111994673) has the molecular formula C21H33Cl2N5O and a molecular weight of 442.44 g/mol. Its IUPAC name is N-[2-[[[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]amino]-(ethylamino)methylidene]amino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[[[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]amino]-(ethylamino)methylidene]amino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 111994673 |
| Molecular Formula | C21H33Cl2N5O |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-[2-[[[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]amino]-(ethylamino)methylidene]amino]ethyl]-2-methylpropanamide |
| SMILES | CCN/C(=N\CCNC(=O)C(C)C)NC1CCN(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C21H33Cl2N5O/c1-4-24-21(26-10-9-25-20(29)15(2)3)27-17-7-11-28(12-8-17)14-16-5-6-18(22)19(23)13-16/h5-6,13,15,17H,4,7-12,14H2,1-3H3,(H,25,29)(H2,24,26,27) |
| InChIKey | BDOQVYZUITUOCK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|