C23H38FN5O2 — CID 111993491
N-[2-[[ethylamino-[[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 111993491) has the molecular formula C23H38FN5O2 and a molecular weight of 435.59 g/mol. Its IUPAC name is N-[2-[[ethylamino-[[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[ethylamino-[[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111993491 |
| Molecular Formula | C23H38FN5O2 |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | N-[2-[[ethylamino-[[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | CCN/C(=N\CCNC(=O)C(C)(C)C)NC1CCN(Cc2ccc(OC)c(F)c2)CC1 |
| InChI | InChI=1S/C23H38FN5O2/c1-6-25-22(27-12-11-26-21(30)23(2,3)4)28-18-9-13-29(14-10-18)16-17-7-8-20(31-5)19(24)15-17/h7-8,15,18H,6,9-14,16H2,1-5H3,(H,26,30)(H2,25,27,28) |
| InChIKey | PPHXFATXRRVJKC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|