C17H34N6O2 — CID 111992127
N-[2-[[[[1-(2-amino-2-oxoethyl)piperidin-4-yl]amino]-(ethylamino)methylidene]amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 111992127) has the molecular formula C17H34N6O2 and a molecular weight of 354.50 g/mol. Its IUPAC name is N-[2-[[[[1-(2-amino-2-oxoethyl)piperidin-4-yl]amino]-(ethylamino)methylidene]amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[[[1-(2-amino-2-oxoethyl)piperidin-4-yl]amino]-(ethylamino)methylidene]amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111992127 |
| Molecular Formula | C17H34N6O2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | N-[2-[[[[1-(2-amino-2-oxoethyl)piperidin-4-yl]amino]-(ethylamino)methylidene]amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | CCN/C(=N\CCNC(=O)C(C)(C)C)NC1CCN(CC(N)=O)CC1 |
| InChI | InChI=1S/C17H34N6O2/c1-5-19-16(21-9-8-20-15(25)17(2,3)4)22-13-6-10-23(11-7-13)12-14(18)24/h13H,5-12H2,1-4H3,(H2,18,24)(H,20,25)(H2,19,21,22) |
| InChIKey | DGWMBVABQDDIPR-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|