C17H32F3IN4O — CID 111992352
N-[2-[[ethylamino-[[4-(trifluoromethyl)cyclohexyl]amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111992352) has the molecular formula C17H32F3IN4O and a molecular weight of 492.37 g/mol. Its IUPAC name is N-[2-[[ethylamino-[[4-(trifluoromethyl)cyclohexyl]amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | N-[2-[[ethylamino-[[4-(trifluoromethyl)cyclohexyl]amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111992352 |
| Molecular Formula | C17H32F3IN4O |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | N-[2-[[ethylamino-[[4-(trifluoromethyl)cyclohexyl]amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)C(C)(C)C)NC1CCC(C(F)(F)F)CC1.I |
| InChI | InChI=1S/C17H31F3N4O.HI/c1-5-21-15(23-11-10-22-14(25)16(2,3)4)24-13-8-6-12(7-9-13)17(18,19)20;/h12-13H,5-11H2,1-4H3,(H,22,25)(H2,21,23,24);1H |
| InChIKey | YFYHYTPVRVFNRL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|