C19H37N5O — CID 111918757
N-[2-[[[(1-cyclopentylpyrrolidin-3-yl)amino]-(ethylamino)methylidene]amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 111918757) has the molecular formula C19H37N5O and a molecular weight of 351.54 g/mol. Its IUPAC name is N-[2-[[[(1-cyclopentylpyrrolidin-3-yl)amino]-(ethylamino)methylidene]amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[[(1-cyclopentylpyrrolidin-3-yl)amino]-(ethylamino)methylidene]amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111918757 |
| Molecular Formula | C19H37N5O |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.30 |
| IUPAC Name | N-[2-[[[(1-cyclopentylpyrrolidin-3-yl)amino]-(ethylamino)methylidene]amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | CCN/C(=N\CCNC(=O)C(C)(C)C)NC1CCN(C2CCCC2)C1 |
| InChI | InChI=1S/C19H37N5O/c1-5-20-18(22-12-11-21-17(25)19(2,3)4)23-15-10-13-24(14-15)16-8-6-7-9-16/h15-16H,5-14H2,1-4H3,(H,21,25)(H2,20,22,23) |
| InChIKey | TWBGJGIXYFGASW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|