C13H25F3IN5O — CID 111991736
2-[4-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]piperidin-1-yl]acetamide;hydroiodide (PubChem CID 111991736) has the molecular formula C13H25F3IN5O and a molecular weight of 451.28 g/mol. Its IUPAC name is 2-[4-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]piperidin-1-yl]acetamide;hydroiodide.
| Compound Name | 2-[4-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]piperidin-1-yl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111991736 |
| Molecular Formula | C13H25F3IN5O |
| Molecular Weight | 451.28 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 2-[4-[[N-ethyl-N'-(3,3,3-trifluoropropyl)carbamimidoyl]amino]piperidin-1-yl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(F)(F)F)NC1CCN(CC(N)=O)CC1.I |
| InChI | InChI=1S/C13H24F3N5O.HI/c1-2-18-12(19-6-5-13(14,15)16)20-10-3-7-21(8-4-10)9-11(17)22;/h10H,2-9H2,1H3,(H2,17,22)(H2,18,19,20);1H |
| InChIKey | MTFBLKRAVCTXSJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|